ChemNet > CAS > 17931-55-4 Bicyclo[3.3.1]nonan-9-one
17931-55-4 Bicyclo[3.3.1]nonan-9-one
Naam product |
Bicyclo[3.3.1]nonan-9-one |
Engelse naam |
Bicyclo[3.3.1]nonan-9-one; |
MF |
C9H14O |
Molecuulgewicht |
138.2069 |
InChI |
InChI=1/C9H14O/c10-9-7-3-1-4-8(9)6-2-5-7/h7-8H,1-6H2 |
CAS-nummer |
17931-55-4 |
EINECS |
241-868-2 |
Moleculaire Structuur |
|
Dichtheid |
1.007g/cm3 |
Smeltpunt |
155-157℃ |
Kookpunt |
219.8°C at 760 mmHg |
Brekingsindex |
1.49 |
Vlampunt |
79.6°C |
Dampdruk |
0.117mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|